C24H20N4S — CID 87591807
(1,2-diphenylindol-3-yl)-(3-methyl-2H-1,3-thiazol-2-yl)diazene (PubChem CID 87591807) has the molecular formula C24H20N4S and a molecular weight of 396.52 g/mol. Its IUPAC name is (1,2-diphenylindol-3-yl)-(3-methyl-2H-1,3-thiazol-2-yl)diazene.
| Compound Name | (1,2-diphenylindol-3-yl)-(3-methyl-2H-1,3-thiazol-2-yl)diazene |
|---|---|
| PubChem CID | 87591807 |
| Molecular Formula | C24H20N4S |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | (1,2-diphenylindol-3-yl)-(3-methyl-2H-1,3-thiazol-2-yl)diazene |
| SMILES | CN1C=CSC1/N=N/c1c(-c2ccccc2)n(-c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C24H20N4S/c1-27-16-17-29-24(27)26-25-22-20-14-8-9-15-21(20)28(19-12-6-3-7-13-19)23(22)18-10-4-2-5-11-18/h2-17,24H,1H3/b26-25+ |
| InChIKey | QKUYPILFJLAWFR-OCEACIFDSA-N |
| XLogP | 6.81 |
| TPSA | 32.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|