C23H21N3 — CID 2319936
N-[(1,2-diphenylindol-3-yl)methylideneamino]-N-methylmethanamine (PubChem CID 2319936) has the molecular formula C23H21N3 and a molecular weight of 339.44 g/mol. Its IUPAC name is N-[(1,2-diphenylindol-3-yl)methylideneamino]-N-methylmethanamine.
| Compound Name | N-[(1,2-diphenylindol-3-yl)methylideneamino]-N-methylmethanamine |
|---|---|
| PubChem CID | 2319936 |
| Molecular Formula | C23H21N3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | N-[(1,2-diphenylindol-3-yl)methylideneamino]-N-methylmethanamine |
| SMILES | CN(C)N=Cc1c(-c2ccccc2)n(-c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C23H21N3/c1-25(2)24-17-21-20-15-9-10-16-22(20)26(19-13-7-4-8-14-19)23(21)18-11-5-3-6-12-18/h3-17H,1-2H3 |
| InChIKey | RXXHJCCQGJMEQZ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 20.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|