C24H17N3O — CID 2361503
(E)-2-cyano-3-(1,2-diphenylindol-3-yl)prop-2-enamide (PubChem CID 2361503) has the molecular formula C24H17N3O and a molecular weight of 363.42 g/mol. Its IUPAC name is (E)-2-cyano-3-(1,2-diphenylindol-3-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(1,2-diphenylindol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 2361503 |
| Molecular Formula | C24H17N3O |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | (E)-2-cyano-3-(1,2-diphenylindol-3-yl)prop-2-enamide |
| SMILES | N#C/C(=C\c1c(-c2ccccc2)n(-c2ccccc2)c2ccccc12)C(N)=O |
| InChI | InChI=1S/C24H17N3O/c25-16-18(24(26)28)15-21-20-13-7-8-14-22(20)27(19-11-5-2-6-12-19)23(21)17-9-3-1-4-10-17/h1-15H,(H2,26,28)/b18-15+ |
| InChIKey | LMJBFLMATQPINJ-OBGWFSINSA-N |
| XLogP | 4.69 |
| TPSA | 71.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|