C27H20ClN3 — CID 4190945
3-chloro-N-[(1,2-diphenylindol-3-yl)methylideneamino]aniline (PubChem CID 4190945) has the molecular formula C27H20ClN3 and a molecular weight of 421.93 g/mol. Its IUPAC name is 3-chloro-N-[(1,2-diphenylindol-3-yl)methylideneamino]aniline.
| Compound Name | 3-chloro-N-[(1,2-diphenylindol-3-yl)methylideneamino]aniline |
|---|---|
| PubChem CID | 4190945 |
| Molecular Formula | C27H20ClN3 |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 3-chloro-N-[(1,2-diphenylindol-3-yl)methylideneamino]aniline |
| SMILES | Clc1cccc(NN=Cc2c(-c3ccccc3)n(-c3ccccc3)c3ccccc23)c1 |
| InChI | InChI=1S/C27H20ClN3/c28-21-12-9-13-22(18-21)30-29-19-25-24-16-7-8-17-26(24)31(23-14-5-2-6-15-23)27(25)20-10-3-1-4-11-20/h1-19,30H |
| InChIKey | FDKHSCSSOSOIKZ-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 29.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|