C26H27N4+ — CID 7025608
(Z)-1-(1,2-diphenylindol-3-yl)-N-(4-methylpiperazin-4-ium-1-yl)methanimine (PubChem CID 7025608) has the molecular formula C26H27N4+ and a molecular weight of 395.53 g/mol. Its IUPAC name is (Z)-1-(1,2-diphenylindol-3-yl)-N-(4-methylpiperazin-4-ium-1-yl)methanimine.
| Compound Name | (Z)-1-(1,2-diphenylindol-3-yl)-N-(4-methylpiperazin-4-ium-1-yl)methanimine |
|---|---|
| PubChem CID | 7025608 |
| Molecular Formula | C26H27N4+ |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | (Z)-1-(1,2-diphenylindol-3-yl)-N-(4-methylpiperazin-4-ium-1-yl)methanimine |
| SMILES | C[NH+]1CCN(/N=C\c2c(-c3ccccc3)n(-c3ccccc3)c3ccccc23)CC1 |
| InChI | InChI=1S/C26H26N4/c1-28-16-18-29(19-17-28)27-20-24-23-14-8-9-15-25(23)30(22-12-6-3-7-13-22)26(24)21-10-4-2-5-11-21/h2-15,20H,16-19H2,1H3/p+1/b27-20- |
| InChIKey | JDISLKYPDVOOHJ-OOAXWGSJSA-O |
| XLogP | 3.46 |
| TPSA | 24.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|