C30H23N5O — CID 6250185
N-[(Z)-(1,2-diphenylindol-3-yl)methylideneamino]-2-methylimidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 6250185) has the molecular formula C30H23N5O and a molecular weight of 469.55 g/mol. Its IUPAC name is N-[(Z)-(1,2-diphenylindol-3-yl)methylideneamino]-2-methylimidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | N-[(Z)-(1,2-diphenylindol-3-yl)methylideneamino]-2-methylimidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 6250185 |
| Molecular Formula | C30H23N5O |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | N-[(Z)-(1,2-diphenylindol-3-yl)methylideneamino]-2-methylimidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | Cc1nc2ccccn2c1C(=O)N/N=C\c1c(-c2ccccc2)n(-c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C30H23N5O/c1-21-28(34-19-11-10-18-27(34)32-21)30(36)33-31-20-25-24-16-8-9-17-26(24)35(23-14-6-3-7-15-23)29(25)22-12-4-2-5-13-22/h2-20H,1H3,(H,33,36)/b31-20- |
| InChIKey | DNGXMOKYSDRHOI-GTWSWNCMSA-N |
| XLogP | 6.02 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|