C33H31N3O2 — CID 6901775
2-(4-tert-butylphenoxy)-N-[(E)-(1,2-diphenylindol-3-yl)methylideneamino]acetamide (PubChem CID 6901775) has the molecular formula C33H31N3O2 and a molecular weight of 501.63 g/mol. Its IUPAC name is 2-(4-tert-butylphenoxy)-N-[(E)-(1,2-diphenylindol-3-yl)methylideneamino]acetamide.
| Compound Name | 2-(4-tert-butylphenoxy)-N-[(E)-(1,2-diphenylindol-3-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6901775 |
| Molecular Formula | C33H31N3O2 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | 2-(4-tert-butylphenoxy)-N-[(E)-(1,2-diphenylindol-3-yl)methylideneamino]acetamide |
| SMILES | CC(C)(C)c1ccc(OCC(=O)N/N=C/c2c(-c3ccccc3)n(-c3ccccc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C33H31N3O2/c1-33(2,3)25-18-20-27(21-19-25)38-23-31(37)35-34-22-29-28-16-10-11-17-30(28)36(26-14-8-5-9-15-26)32(29)24-12-6-4-7-13-24/h4-22H,23H2,1-3H3,(H,35,37)/b34-22+ |
| InChIKey | JVGPGDJVIKPAJT-PPOKSSTKSA-N |
| XLogP | 7.12 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|