C30H22N4O — CID 6902143
N-[(E)-(1,2-diphenylindol-3-yl)methylideneamino]-1H-indole-3-carboxamide (PubChem CID 6902143) has the molecular formula C30H22N4O and a molecular weight of 454.53 g/mol. Its IUPAC name is N-[(E)-(1,2-diphenylindol-3-yl)methylideneamino]-1H-indole-3-carboxamide.
| Compound Name | N-[(E)-(1,2-diphenylindol-3-yl)methylideneamino]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 6902143 |
| Molecular Formula | C30H22N4O |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | N-[(E)-(1,2-diphenylindol-3-yl)methylideneamino]-1H-indole-3-carboxamide |
| SMILES | O=C(N/N=C/c1c(-c2ccccc2)n(-c2ccccc2)c2ccccc12)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C30H22N4O/c35-30(26-19-31-27-17-9-7-15-23(26)27)33-32-20-25-24-16-8-10-18-28(24)34(22-13-5-2-6-14-22)29(25)21-11-3-1-4-12-21/h1-20,31H,(H,33,35)/b32-20+ |
| InChIKey | SBVVBFYTOFGWQG-UZWMFBFFSA-N |
| XLogP | 6.54 |
| TPSA | 62.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|