C20H16N4O3 — CID 11588540
methyl 3-[(Z)-(1H-indole-3-carbonylhydrazinylidene)methyl]indole-1-carboxylate (PubChem CID 11588540) has the molecular formula C20H16N4O3 and a molecular weight of 360.37 g/mol. Its IUPAC name is methyl 3-[(Z)-(1H-indole-3-carbonylhydrazinylidene)methyl]indole-1-carboxylate.
| Compound Name | methyl 3-[(Z)-(1H-indole-3-carbonylhydrazinylidene)methyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 11588540 |
| Molecular Formula | C20H16N4O3 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | methyl 3-[(Z)-(1H-indole-3-carbonylhydrazinylidene)methyl]indole-1-carboxylate |
| SMILES | COC(=O)n1cc(/C=N\NC(=O)c2c[nH]c3ccccc23)c2ccccc21 |
| InChI | InChI=1S/C20H16N4O3/c1-27-20(26)24-12-13(14-6-3-5-9-18(14)24)10-22-23-19(25)16-11-21-17-8-4-2-7-15(16)17/h2-12,21H,1H3,(H,23,25)/b22-10- |
| InChIKey | ACHCLUUTVBSBCH-YVNNLAQVSA-N |
| XLogP | 3.50 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|