About N-(2,4-dimethylphenyl)-1-(1,2-diphenylindol-3-yl)methanimine
N-(2,4-dimethylphenyl)-1-(1,2-diphenylindol-3-yl)methanimine (PubChem CID 2307285) has the molecular formula C29H24N2
and a molecular weight of 400.53 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-1-(1,2-diphenylindol-3-yl)methanimine.
Molecular Properties
| Compound Name | N-(2,4-dimethylphenyl)-1-(1,2-diphenylindol-3-yl)methanimine |
| PubChem CID | 2307285 |
| Molecular Formula | C29H24N2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | N-(2,4-dimethylphenyl)-1-(1,2-diphenylindol-3-yl)methanimine |
| SMILES | Cc1ccc(/N=C/c2c(-c3ccccc3)n(-c3ccccc3)c3ccccc23)c(C)c1 |
| InChI | InChI=1S/C29H24N2/c1-21-17-18-27(22(2)19-21)30-20-26-25-15-9-10-16-28(25)31(24-13-7-4-8-14-24)29(26)23-11-5-3-6-12-23/h3-20H,1-2H3/b30-20+ |
| InChIKey | YMGFCNSRCFOJRR-TWKHWXDSSA-N |
| XLogP | 7.66 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(2,4-dimethylphenyl)-1-(1,2-diphenylindol-3-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,4-dimethylphenyl)-1-(1,2-diphenylindol-3-yl)methanimine?
The IUPAC name of N-(2,4-dimethylphenyl)-1-(1,2-diphenylindol-3-yl)methanimine (CID 2307285) is N-(2,4-dimethylphenyl)-1-(1,2-diphenylindol-3-yl)methanimine.
What is the SMILES notation for N-(2,4-dimethylphenyl)-1-(1,2-diphenylindol-3-yl)methanimine?
The canonical SMILES for N-(2,4-dimethylphenyl)-1-(1,2-diphenylindol-3-yl)methanimine is Cc1ccc(/N=C/c2c(-c3ccccc3)n(-c3ccccc3)c3ccccc23)c(C)c1.
What is the InChIKey of N-(2,4-dimethylphenyl)-1-(1,2-diphenylindol-3-yl)methanimine?
The InChIKey is YMGFCNSRCFOJRR-TWKHWXDSSA-N. The full InChI is InChI=1S/C29H24N2/c1-21-17-18-27(22(2)19-21)30-20-26-25-15-9-10-16-28(25)31(24-13-7-4-8-14-24)29(26)23-11-5-3-6-12-23/h3-20H,1-2H3/b30-20+.
What are the key properties of N-(2,4-dimethylphenyl)-1-(1,2-diphenylindol-3-yl)methanimine?
N-(2,4-dimethylphenyl)-1-(1,2-diphenylindol-3-yl)methanimine has a molecular weight of 400.53 g/mol, XLogP of 7.66, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,4-dimethylphenyl)-1-(1,2-diphenylindol-3-yl)methanimine is sourced from PubChem (CID 2307285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).