C35H36N4O3S — CID 4162312
2-[(1,2-diphenylindol-3-yl)methylideneamino]-N,N-diethyl-4-morpholin-4-ylsulfonylaniline (PubChem CID 4162312) has the molecular formula C35H36N4O3S and a molecular weight of 592.77 g/mol. Its IUPAC name is 2-[(1,2-diphenylindol-3-yl)methylideneamino]-N,N-diethyl-4-morpholin-4-ylsulfonylaniline.
| Compound Name | 2-[(1,2-diphenylindol-3-yl)methylideneamino]-N,N-diethyl-4-morpholin-4-ylsulfonylaniline |
|---|---|
| PubChem CID | 4162312 |
| Molecular Formula | C35H36N4O3S |
| Molecular Weight | 592.77 g/mol |
| Exact Mass | 592.25 |
| IUPAC Name | 2-[(1,2-diphenylindol-3-yl)methylideneamino]-N,N-diethyl-4-morpholin-4-ylsulfonylaniline |
| SMILES | CCN(CC)c1ccc(S(=O)(=O)N2CCOCC2)cc1/N=C/c1c(-c2ccccc2)n(-c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C35H36N4O3S/c1-3-37(4-2)34-20-19-29(43(40,41)38-21-23-42-24-22-38)25-32(34)36-26-31-30-17-11-12-18-33(30)39(28-15-9-6-10-16-28)35(31)27-13-7-5-8-14-27/h5-20,25-26H,3-4,21-24H2,1-2H3/b36-26+ |
| InChIKey | DSWUGRXIDRSPPB-LZBRRTOVSA-N |
| XLogP | 6.92 |
| TPSA | 67.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.77 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|