C24H21ClN4O3S2 — CID 4083943
N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-1-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methanimine (PubChem CID 4083943) has the molecular formula C24H21ClN4O3S2 and a molecular weight of 513.04 g/mol. Its IUPAC name is N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-1-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methanimine.
| Compound Name | N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-1-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methanimine |
|---|---|
| PubChem CID | 4083943 |
| Molecular Formula | C24H21ClN4O3S2 |
| Molecular Weight | 513.04 g/mol |
| Exact Mass | 512.07 |
| IUPAC Name | N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-1-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methanimine |
| SMILES | O=S(=O)(c1ccc(Cl)c(/N=C/c2cn(-c3ccccc3)nc2-c2cccs2)c1)N1CCOCC1 |
| InChI | InChI=1S/C24H21ClN4O3S2/c25-21-9-8-20(34(30,31)28-10-12-32-13-11-28)15-22(21)26-16-18-17-29(19-5-2-1-3-6-19)27-24(18)23-7-4-14-33-23/h1-9,14-17H,10-13H2/b26-16+ |
| InChIKey | HIWPWVUQQBIWDT-WGOQTCKBSA-N |
| XLogP | 5.03 |
| TPSA | 76.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.04 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|