C28H26N4O3S2 — CID 75535836
(E)-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)-1-(6-pyrrolidin-1-ylsulfonyl-2,3-dihydroindol-1-yl)prop-2-en-1-one (PubChem CID 75535836) has the molecular formula C28H26N4O3S2 and a molecular weight of 530.68 g/mol. Its IUPAC name is (E)-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)-1-(6-pyrrolidin-1-ylsulfonyl-2,3-dihydroindol-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)-1-(6-pyrrolidin-1-ylsulfonyl-2,3-dihydroindol-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 75535836 |
| Molecular Formula | C28H26N4O3S2 |
| Molecular Weight | 530.68 g/mol |
| Exact Mass | 530.14 |
| IUPAC Name | (E)-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)-1-(6-pyrrolidin-1-ylsulfonyl-2,3-dihydroindol-1-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cn(-c2ccccc2)nc1-c1cccs1)N1CCc2ccc(S(=O)(=O)N3CCCC3)cc21 |
| InChI | InChI=1S/C28H26N4O3S2/c33-27(31-17-14-21-10-12-24(19-25(21)31)37(34,35)30-15-4-5-16-30)13-11-22-20-32(23-7-2-1-3-8-23)29-28(22)26-9-6-18-36-26/h1-3,6-13,18-20H,4-5,14-17H2/b13-11+ |
| InChIKey | IZHMRRHZCVOPKW-ACCUITESSA-N |
| XLogP | 4.99 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.68 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|