C28H25N3O3 — CID 2338764
(E)-1-(2,3-dihydroindol-1-yl)-3-[3-(3,4-dimethoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-en-1-one (PubChem CID 2338764) has the molecular formula C28H25N3O3 and a molecular weight of 451.53 g/mol. Its IUPAC name is (E)-1-(2,3-dihydroindol-1-yl)-3-[3-(3,4-dimethoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(2,3-dihydroindol-1-yl)-3-[3-(3,4-dimethoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 2338764 |
| Molecular Formula | C28H25N3O3 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | (E)-1-(2,3-dihydroindol-1-yl)-3-[3-(3,4-dimethoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-en-1-one |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2/C=C/C(=O)N2CCc3ccccc32)cc1OC |
| InChI | InChI=1S/C28H25N3O3/c1-33-25-14-12-21(18-26(25)34-2)28-22(19-31(29-28)23-9-4-3-5-10-23)13-15-27(32)30-17-16-20-8-6-7-11-24(20)30/h3-15,18-19H,16-17H2,1-2H3/b15-13+ |
| InChIKey | AAIFTBPVZSGAQO-FYWRMAATSA-N |
| XLogP | 5.16 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|