C24H22N2O6 — CID 4826306
(2-oxooxolan-3-yl) 3-[3-(3,4-dimethoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-enoate (PubChem CID 4826306) has the molecular formula C24H22N2O6 and a molecular weight of 434.45 g/mol. Its IUPAC name is (2-oxooxolan-3-yl) 3-[3-(3,4-dimethoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-enoate.
| Compound Name | (2-oxooxolan-3-yl) 3-[3-(3,4-dimethoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 4826306 |
| Molecular Formula | C24H22N2O6 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | (2-oxooxolan-3-yl) 3-[3-(3,4-dimethoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-enoate |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2C=CC(=O)OC2CCOC2=O)cc1OC |
| InChI | InChI=1S/C24H22N2O6/c1-29-19-10-8-16(14-21(19)30-2)23-17(15-26(25-23)18-6-4-3-5-7-18)9-11-22(27)32-20-12-13-31-24(20)28/h3-11,14-15,20H,12-13H2,1-2H3 |
| InChIKey | GSTFKLAYBVTDJQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 88.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|