About [(3S)-2-oxooxolan-3-yl] 3-(2,5-dimethoxyphenyl)-1-phenylpyrazole-4-carboxylate
[(3S)-2-oxooxolan-3-yl] 3-(2,5-dimethoxyphenyl)-1-phenylpyrazole-4-carboxylate (PubChem CID 7684985) has the molecular formula C22H20N2O6
and a molecular weight of 408.41 g/mol. Its IUPAC name is [(3S)-2-oxooxolan-3-yl] 3-(2,5-dimethoxyphenyl)-1-phenylpyrazole-4-carboxylate.
Molecular Properties
| Compound Name | [(3S)-2-oxooxolan-3-yl] 3-(2,5-dimethoxyphenyl)-1-phenylpyrazole-4-carboxylate |
| PubChem CID | 7684985 |
| Molecular Formula | C22H20N2O6 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | [(3S)-2-oxooxolan-3-yl] 3-(2,5-dimethoxyphenyl)-1-phenylpyrazole-4-carboxylate |
| SMILES | COc1ccc(OC)c(-c2nn(-c3ccccc3)cc2C(=O)O[C@H]2CCOC2=O)c1 |
| InChI | InChI=1S/C22H20N2O6/c1-27-15-8-9-18(28-2)16(12-15)20-17(21(25)30-19-10-11-29-22(19)26)13-24(23-20)14-6-4-3-5-7-14/h3-9,12-13,19H,10-11H2,1-2H3/t19-/m0/s1 |
| InChIKey | RUENXKCKDWTSES-IBGZPJMESA-N |
| XLogP | 3.03 |
| TPSA | 88.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [(3S)-2-oxooxolan-3-yl] 3-(2,5-dimethoxyphenyl)-1-phenylpyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-2-oxooxolan-3-yl] 3-(2,5-dimethoxyphenyl)-1-phenylpyrazole-4-carboxylate?
The IUPAC name of [(3S)-2-oxooxolan-3-yl] 3-(2,5-dimethoxyphenyl)-1-phenylpyrazole-4-carboxylate (CID 7684985) is [(3S)-2-oxooxolan-3-yl] 3-(2,5-dimethoxyphenyl)-1-phenylpyrazole-4-carboxylate.
What is the SMILES notation for [(3S)-2-oxooxolan-3-yl] 3-(2,5-dimethoxyphenyl)-1-phenylpyrazole-4-carboxylate?
The canonical SMILES for [(3S)-2-oxooxolan-3-yl] 3-(2,5-dimethoxyphenyl)-1-phenylpyrazole-4-carboxylate is COc1ccc(OC)c(-c2nn(-c3ccccc3)cc2C(=O)O[C@H]2CCOC2=O)c1.
What is the InChIKey of [(3S)-2-oxooxolan-3-yl] 3-(2,5-dimethoxyphenyl)-1-phenylpyrazole-4-carboxylate?
The InChIKey is RUENXKCKDWTSES-IBGZPJMESA-N. The full InChI is InChI=1S/C22H20N2O6/c1-27-15-8-9-18(28-2)16(12-15)20-17(21(25)30-19-10-11-29-22(19)26)13-24(23-20)14-6-4-3-5-7-14/h3-9,12-13,19H,10-11H2,1-2H3/t19-/m0/s1.
What are the key properties of [(3S)-2-oxooxolan-3-yl] 3-(2,5-dimethoxyphenyl)-1-phenylpyrazole-4-carboxylate?
[(3S)-2-oxooxolan-3-yl] 3-(2,5-dimethoxyphenyl)-1-phenylpyrazole-4-carboxylate has a molecular weight of 408.41 g/mol, XLogP of 3.03, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-2-oxooxolan-3-yl] 3-(2,5-dimethoxyphenyl)-1-phenylpyrazole-4-carboxylate is sourced from PubChem (CID 7684985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).