C22H24N4O3 — CID 119402162
[3-(2,5-dimethoxyphenyl)-1-phenylpyrazol-4-yl]-piperazin-1-ylmethanone (PubChem CID 119402162) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is [3-(2,5-dimethoxyphenyl)-1-phenylpyrazol-4-yl]-piperazin-1-ylmethanone.
| Compound Name | [3-(2,5-dimethoxyphenyl)-1-phenylpyrazol-4-yl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 119402162 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | [3-(2,5-dimethoxyphenyl)-1-phenylpyrazol-4-yl]-piperazin-1-ylmethanone |
| SMILES | COc1ccc(OC)c(-c2nn(-c3ccccc3)cc2C(=O)N2CCNCC2)c1 |
| InChI | InChI=1S/C22H24N4O3/c1-28-17-8-9-20(29-2)18(14-17)21-19(22(27)25-12-10-23-11-13-25)15-26(24-21)16-6-4-3-5-7-16/h3-9,14-15,23H,10-13H2,1-2H3 |
| InChIKey | KKINYNUGYPOTFN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |