C25H29N3O3 — CID 112793142
azocan-1-yl-[3-(2,4-dimethoxyphenyl)-1-phenylpyrazol-4-yl]methanone (PubChem CID 112793142) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is azocan-1-yl-[3-(2,4-dimethoxyphenyl)-1-phenylpyrazol-4-yl]methanone.
| Compound Name | azocan-1-yl-[3-(2,4-dimethoxyphenyl)-1-phenylpyrazol-4-yl]methanone |
|---|---|
| PubChem CID | 112793142 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | azocan-1-yl-[3-(2,4-dimethoxyphenyl)-1-phenylpyrazol-4-yl]methanone |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2C(=O)N2CCCCCCC2)c(OC)c1 |
| InChI | InChI=1S/C25H29N3O3/c1-30-20-13-14-21(23(17-20)31-2)24-22(18-28(26-24)19-11-7-6-8-12-19)25(29)27-15-9-4-3-5-10-16-27/h6-8,11-14,17-18H,3-5,9-10,15-16H2,1-2H3 |
| InChIKey | ROMPVANJKKMFGN-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |