C27H26N4O3 — CID 112763080
[4-(4-hydroxyphenyl)piperazin-1-yl]-[3-(2-methoxyphenyl)-1-phenylpyrazol-4-yl]methanone (PubChem CID 112763080) has the molecular formula C27H26N4O3 and a molecular weight of 454.53 g/mol. Its IUPAC name is [4-(4-hydroxyphenyl)piperazin-1-yl]-[3-(2-methoxyphenyl)-1-phenylpyrazol-4-yl]methanone.
| Compound Name | [4-(4-hydroxyphenyl)piperazin-1-yl]-[3-(2-methoxyphenyl)-1-phenylpyrazol-4-yl]methanone |
|---|---|
| PubChem CID | 112763080 |
| Molecular Formula | C27H26N4O3 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | [4-(4-hydroxyphenyl)piperazin-1-yl]-[3-(2-methoxyphenyl)-1-phenylpyrazol-4-yl]methanone |
| SMILES | COc1ccccc1-c1nn(-c2ccccc2)cc1C(=O)N1CCN(c2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C27H26N4O3/c1-34-25-10-6-5-9-23(25)26-24(19-31(28-26)21-7-3-2-4-8-21)27(33)30-17-15-29(16-18-30)20-11-13-22(32)14-12-20/h2-14,19,32H,15-18H2,1H3 |
| InChIKey | KKLQVVSLZJKCBR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |