C26H25N5O2 — CID 32947167
3-(2-methoxyphenyl)-1-phenyl-N-(5-pyrrolidin-1-yl-2-pyridinyl)pyrazole-4-carboxamide (PubChem CID 32947167) has the molecular formula C26H25N5O2 and a molecular weight of 439.52 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-1-phenyl-N-(5-pyrrolidin-1-yl-2-pyridinyl)pyrazole-4-carboxamide.
| Compound Name | 3-(2-methoxyphenyl)-1-phenyl-N-(5-pyrrolidin-1-yl-2-pyridinyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 32947167 |
| Molecular Formula | C26H25N5O2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 3-(2-methoxyphenyl)-1-phenyl-N-(5-pyrrolidin-1-yl-2-pyridinyl)pyrazole-4-carboxamide |
| SMILES | COc1ccccc1-c1nn(-c2ccccc2)cc1C(=O)Nc1ccc(N2CCCC2)cn1 |
| InChI | InChI=1S/C26H25N5O2/c1-33-23-12-6-5-11-21(23)25-22(18-31(29-25)19-9-3-2-4-10-19)26(32)28-24-14-13-20(17-27-24)30-15-7-8-16-30/h2-6,9-14,17-18H,7-8,15-16H2,1H3,(H,27,28,32) |
| InChIKey | OBPSHOFEYQWCBJ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |