C29H29N5O3 — CID 112827519
4-[[4-[3-(2-methoxyphenyl)-1-phenylpyrazole-4-carbonyl]piperazin-1-yl]methyl]benzamide (PubChem CID 112827519) has the molecular formula C29H29N5O3 and a molecular weight of 495.58 g/mol. Its IUPAC name is 4-[[4-[3-(2-methoxyphenyl)-1-phenylpyrazole-4-carbonyl]piperazin-1-yl]methyl]benzamide.
| Compound Name | 4-[[4-[3-(2-methoxyphenyl)-1-phenylpyrazole-4-carbonyl]piperazin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 112827519 |
| Molecular Formula | C29H29N5O3 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | 4-[[4-[3-(2-methoxyphenyl)-1-phenylpyrazole-4-carbonyl]piperazin-1-yl]methyl]benzamide |
| SMILES | COc1ccccc1-c1nn(-c2ccccc2)cc1C(=O)N1CCN(Cc2ccc(C(N)=O)cc2)CC1 |
| InChI | InChI=1S/C29H29N5O3/c1-37-26-10-6-5-9-24(26)27-25(20-34(31-27)23-7-3-2-4-8-23)29(36)33-17-15-32(16-18-33)19-21-11-13-22(14-12-21)28(30)35/h2-14,20H,15-19H2,1H3,(H2,30,35) |
| InChIKey | HUBDHEYNTSKGDY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 93.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |