C22H20N4O5 — CID 46872458
5-[[3-(2,5-dimethoxyphenyl)-1-phenylpyrazol-4-yl]methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 46872458) has the molecular formula C22H20N4O5 and a molecular weight of 420.43 g/mol. Its IUPAC name is 5-[[3-(2,5-dimethoxyphenyl)-1-phenylpyrazol-4-yl]methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[3-(2,5-dimethoxyphenyl)-1-phenylpyrazol-4-yl]methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 46872458 |
| Molecular Formula | C22H20N4O5 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 5-[[3-(2,5-dimethoxyphenyl)-1-phenylpyrazol-4-yl]methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | COc1ccc(OC)c(-c2nn(-c3ccccc3)cc2CC2C(=O)NC(=O)NC2=O)c1 |
| InChI | InChI=1S/C22H20N4O5/c1-30-15-8-9-18(31-2)16(11-15)19-13(10-17-20(27)23-22(29)24-21(17)28)12-26(25-19)14-6-4-3-5-7-14/h3-9,11-12,17H,10H2,1-2H3,(H2,23,24,27,28,29) |
| InChIKey | RYAXYAQSVIIEHH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|