C23H25N3O4 — CID 56559378
3-(2,5-dimethoxyphenyl)-N-(oxan-3-yl)-1-phenylpyrazole-4-carboxamide (PubChem CID 56559378) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is 3-(2,5-dimethoxyphenyl)-N-(oxan-3-yl)-1-phenylpyrazole-4-carboxamide.
| Compound Name | 3-(2,5-dimethoxyphenyl)-N-(oxan-3-yl)-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 56559378 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 3-(2,5-dimethoxyphenyl)-N-(oxan-3-yl)-1-phenylpyrazole-4-carboxamide |
| SMILES | COc1ccc(OC)c(-c2nn(-c3ccccc3)cc2C(=O)NC2CCCOC2)c1 |
| InChI | InChI=1S/C23H25N3O4/c1-28-18-10-11-21(29-2)19(13-18)22-20(23(27)24-16-7-6-12-30-15-16)14-26(25-22)17-8-4-3-5-9-17/h3-5,8-11,13-14,16H,6-7,12,15H2,1-2H3,(H,24,27) |
| InChIKey | BMNDQYJRDBBJRH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |