C26H24FN3O4 — CID 55657345
3-(2,5-dimethoxyphenyl)-N-[2-(3-fluorophenoxy)ethyl]-1-phenylpyrazole-4-carboxamide (PubChem CID 55657345) has the molecular formula C26H24FN3O4 and a molecular weight of 461.49 g/mol. Its IUPAC name is 3-(2,5-dimethoxyphenyl)-N-[2-(3-fluorophenoxy)ethyl]-1-phenylpyrazole-4-carboxamide.
| Compound Name | 3-(2,5-dimethoxyphenyl)-N-[2-(3-fluorophenoxy)ethyl]-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55657345 |
| Molecular Formula | C26H24FN3O4 |
| Molecular Weight | 461.49 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 3-(2,5-dimethoxyphenyl)-N-[2-(3-fluorophenoxy)ethyl]-1-phenylpyrazole-4-carboxamide |
| SMILES | COc1ccc(OC)c(-c2nn(-c3ccccc3)cc2C(=O)NCCOc2cccc(F)c2)c1 |
| InChI | InChI=1S/C26H24FN3O4/c1-32-20-11-12-24(33-2)22(16-20)25-23(17-30(29-25)19-8-4-3-5-9-19)26(31)28-13-14-34-21-10-6-7-18(27)15-21/h3-12,15-17H,13-14H2,1-2H3,(H,28,31) |
| InChIKey | VKKPHLSOSRVEJR-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.49 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|