C27H27N3O5 — CID 46399913
3-(2,4-dimethoxyphenyl)-N-[2-(3-methoxyphenoxy)ethyl]-1-phenylpyrazole-4-carboxamide (PubChem CID 46399913) has the molecular formula C27H27N3O5 and a molecular weight of 473.53 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-N-[2-(3-methoxyphenoxy)ethyl]-1-phenylpyrazole-4-carboxamide.
| Compound Name | 3-(2,4-dimethoxyphenyl)-N-[2-(3-methoxyphenoxy)ethyl]-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 46399913 |
| Molecular Formula | C27H27N3O5 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-N-[2-(3-methoxyphenoxy)ethyl]-1-phenylpyrazole-4-carboxamide |
| SMILES | COc1cccc(OCCNC(=O)c2cn(-c3ccccc3)nc2-c2ccc(OC)cc2OC)c1 |
| InChI | InChI=1S/C27H27N3O5/c1-32-20-10-7-11-22(16-20)35-15-14-28-27(31)24-18-30(19-8-5-4-6-9-19)29-26(24)23-13-12-21(33-2)17-25(23)34-3/h4-13,16-18H,14-15H2,1-3H3,(H,28,31) |
| InChIKey | FDCYZJDIDSZBDW-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|