C26H33N5O3 — CID 60605961
3-(2,4-dimethoxyphenyl)-N-[3-(4-methylpiperazin-1-yl)propyl]-1-phenylpyrazole-4-carboxamide (PubChem CID 60605961) has the molecular formula C26H33N5O3 and a molecular weight of 463.58 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-N-[3-(4-methylpiperazin-1-yl)propyl]-1-phenylpyrazole-4-carboxamide.
| Compound Name | 3-(2,4-dimethoxyphenyl)-N-[3-(4-methylpiperazin-1-yl)propyl]-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 60605961 |
| Molecular Formula | C26H33N5O3 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.26 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-N-[3-(4-methylpiperazin-1-yl)propyl]-1-phenylpyrazole-4-carboxamide |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2C(=O)NCCCN2CCN(C)CC2)c(OC)c1 |
| InChI | InChI=1S/C26H33N5O3/c1-29-14-16-30(17-15-29)13-7-12-27-26(32)23-19-31(20-8-5-4-6-9-20)28-25(23)22-11-10-21(33-2)18-24(22)34-3/h4-6,8-11,18-19H,7,12-17H2,1-3H3,(H,27,32) |
| InChIKey | WTCMUUXLWPRLEL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 71.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|