C18H14N2O4S — CID 2579305
[(3S)-2-oxooxolan-3-yl] 1-phenyl-3-thiophen-2-ylpyrazole-4-carboxylate (PubChem CID 2579305) has the molecular formula C18H14N2O4S and a molecular weight of 354.39 g/mol. Its IUPAC name is [(3S)-2-oxooxolan-3-yl] 1-phenyl-3-thiophen-2-ylpyrazole-4-carboxylate.
| Compound Name | [(3S)-2-oxooxolan-3-yl] 1-phenyl-3-thiophen-2-ylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 2579305 |
| Molecular Formula | C18H14N2O4S |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | [(3S)-2-oxooxolan-3-yl] 1-phenyl-3-thiophen-2-ylpyrazole-4-carboxylate |
| SMILES | O=C(O[C@H]1CCOC1=O)c1cn(-c2ccccc2)nc1-c1cccs1 |
| InChI | InChI=1S/C18H14N2O4S/c21-17(24-14-8-9-23-18(14)22)13-11-20(12-5-2-1-3-6-12)19-16(13)15-7-4-10-25-15/h1-7,10-11,14H,8-9H2/t14-/m0/s1 |
| InChIKey | YWTYEOQGHRDPEN-AWEZNQCLSA-N |
| XLogP | 3.07 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |