C21H18N2O4 — CID 8536992
[(3S)-2-oxooxolan-3-yl] 1-benzyl-3-phenylpyrazole-4-carboxylate (PubChem CID 8536992) has the molecular formula C21H18N2O4 and a molecular weight of 362.38 g/mol. Its IUPAC name is [(3S)-2-oxooxolan-3-yl] 1-benzyl-3-phenylpyrazole-4-carboxylate.
| Compound Name | [(3S)-2-oxooxolan-3-yl] 1-benzyl-3-phenylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 8536992 |
| Molecular Formula | C21H18N2O4 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | [(3S)-2-oxooxolan-3-yl] 1-benzyl-3-phenylpyrazole-4-carboxylate |
| SMILES | O=C(O[C@H]1CCOC1=O)c1cn(Cc2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C21H18N2O4/c24-20(27-18-11-12-26-21(18)25)17-14-23(13-15-7-3-1-4-8-15)22-19(17)16-9-5-2-6-10-16/h1-10,14,18H,11-13H2/t18-/m0/s1 |
| InChIKey | YOPSVHYWAUCCOK-SFHVURJKSA-N |
| XLogP | 3.07 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |