C23H20N2O4 — CID 8979905
[(3R)-2-oxooxolan-3-yl] (E)-3-(1-benzyl-3-phenylpyrazol-4-yl)prop-2-enoate (PubChem CID 8979905) has the molecular formula C23H20N2O4 and a molecular weight of 388.42 g/mol. Its IUPAC name is [(3R)-2-oxooxolan-3-yl] (E)-3-(1-benzyl-3-phenylpyrazol-4-yl)prop-2-enoate.
| Compound Name | [(3R)-2-oxooxolan-3-yl] (E)-3-(1-benzyl-3-phenylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8979905 |
| Molecular Formula | C23H20N2O4 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | [(3R)-2-oxooxolan-3-yl] (E)-3-(1-benzyl-3-phenylpyrazol-4-yl)prop-2-enoate |
| SMILES | O=C(/C=C/c1cn(Cc2ccccc2)nc1-c1ccccc1)O[C@@H]1CCOC1=O |
| InChI | InChI=1S/C23H20N2O4/c26-21(29-20-13-14-28-23(20)27)12-11-19-16-25(15-17-7-3-1-4-8-17)24-22(19)18-9-5-2-6-10-18/h1-12,16,20H,13-15H2/b12-11+/t20-/m1/s1 |
| InChIKey | WGSXCMQMHNFSKW-YVNCXZRQSA-N |
| XLogP | 3.47 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|