C24H22N4O3 — CID 8979865
[2-(2-cyanoethylamino)-2-oxoethyl] (E)-3-(1-benzyl-3-phenylpyrazol-4-yl)prop-2-enoate (PubChem CID 8979865) has the molecular formula C24H22N4O3 and a molecular weight of 414.47 g/mol. Its IUPAC name is [2-(2-cyanoethylamino)-2-oxoethyl] (E)-3-(1-benzyl-3-phenylpyrazol-4-yl)prop-2-enoate.
| Compound Name | [2-(2-cyanoethylamino)-2-oxoethyl] (E)-3-(1-benzyl-3-phenylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8979865 |
| Molecular Formula | C24H22N4O3 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | [2-(2-cyanoethylamino)-2-oxoethyl] (E)-3-(1-benzyl-3-phenylpyrazol-4-yl)prop-2-enoate |
| SMILES | N#CCCNC(=O)COC(=O)/C=C/c1cn(Cc2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C24H22N4O3/c25-14-7-15-26-22(29)18-31-23(30)13-12-21-17-28(16-19-8-3-1-4-9-19)27-24(21)20-10-5-2-6-11-20/h1-6,8-13,17H,7,15-16,18H2,(H,26,29)/b13-12+ |
| InChIKey | NKVJSWNBGUEDOY-OUKQBFOZSA-N |
| XLogP | 3.18 |
| TPSA | 97.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|