C21H18N2O5 — CID 75364988
(2-oxooxolan-3-yl) (E)-3-[3-(5-methylfuran-2-yl)-1-phenylpyrazol-4-yl]prop-2-enoate (PubChem CID 75364988) has the molecular formula C21H18N2O5 and a molecular weight of 378.38 g/mol. Its IUPAC name is (2-oxooxolan-3-yl) (E)-3-[3-(5-methylfuran-2-yl)-1-phenylpyrazol-4-yl]prop-2-enoate.
| Compound Name | (2-oxooxolan-3-yl) (E)-3-[3-(5-methylfuran-2-yl)-1-phenylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 75364988 |
| Molecular Formula | C21H18N2O5 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | (2-oxooxolan-3-yl) (E)-3-[3-(5-methylfuran-2-yl)-1-phenylpyrazol-4-yl]prop-2-enoate |
| SMILES | Cc1ccc(-c2nn(-c3ccccc3)cc2/C=C/C(=O)OC2CCOC2=O)o1 |
| InChI | InChI=1S/C21H18N2O5/c1-14-7-9-17(27-14)20-15(13-23(22-20)16-5-3-2-4-6-16)8-10-19(24)28-18-11-12-26-21(18)25/h2-10,13,18H,11-12H2,1H3/b10-8+ |
| InChIKey | QAZPZAXJUCWKMP-CSKARUKUSA-N |
| XLogP | 3.31 |
| TPSA | 83.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|