C24H24N6O2 — CID 103599366
N-[2-(4-cyclopropyl-1,2,4-triazol-3-yl)ethyl]-3-[3-(5-methylfuran-2-yl)-1-phenylpyrazol-4-yl]prop-2-enamide (PubChem CID 103599366) has the molecular formula C24H24N6O2 and a molecular weight of 428.50 g/mol. Its IUPAC name is N-[2-(4-cyclopropyl-1,2,4-triazol-3-yl)ethyl]-3-[3-(5-methylfuran-2-yl)-1-phenylpyrazol-4-yl]prop-2-enamide.
| Compound Name | N-[2-(4-cyclopropyl-1,2,4-triazol-3-yl)ethyl]-3-[3-(5-methylfuran-2-yl)-1-phenylpyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 103599366 |
| Molecular Formula | C24H24N6O2 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | N-[2-(4-cyclopropyl-1,2,4-triazol-3-yl)ethyl]-3-[3-(5-methylfuran-2-yl)-1-phenylpyrazol-4-yl]prop-2-enamide |
| SMILES | Cc1ccc(-c2nn(-c3ccccc3)cc2C=CC(=O)NCCc2nncn2C2CC2)o1 |
| InChI | InChI=1S/C24H24N6O2/c1-17-7-11-21(32-17)24-18(15-30(28-24)20-5-3-2-4-6-20)8-12-23(31)25-14-13-22-27-26-16-29(22)19-9-10-19/h2-8,11-12,15-16,19H,9-10,13-14H2,1H3,(H,25,31) |
| InChIKey | KTNLLTYLFMYKBV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 90.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|