C27H25N3O2 — CID 31415184
(1-benzyl-3-phenylpyrazol-4-yl)-[(2R)-2-phenylmorpholin-4-yl]methanone (PubChem CID 31415184) has the molecular formula C27H25N3O2 and a molecular weight of 423.52 g/mol. Its IUPAC name is (1-benzyl-3-phenylpyrazol-4-yl)-[(2R)-2-phenylmorpholin-4-yl]methanone.
| Compound Name | (1-benzyl-3-phenylpyrazol-4-yl)-[(2R)-2-phenylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 31415184 |
| Molecular Formula | C27H25N3O2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | (1-benzyl-3-phenylpyrazol-4-yl)-[(2R)-2-phenylmorpholin-4-yl]methanone |
| SMILES | O=C(c1cn(Cc2ccccc2)nc1-c1ccccc1)N1CCO[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C27H25N3O2/c31-27(29-16-17-32-25(20-29)22-12-6-2-7-13-22)24-19-30(18-21-10-4-1-5-11-21)28-26(24)23-14-8-3-9-15-23/h1-15,19,25H,16-18,20H2/t25-/m0/s1 |
| InChIKey | HBIJNZCFZABXSR-VWLOTQADSA-N |
| XLogP | 4.81 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |