C23H23N3O3S — CID 9272475
methyl (2R)-4-(1-benzyl-3-phenylpyrazole-4-carbonyl)thiomorpholine-2-carboxylate (PubChem CID 9272475) has the molecular formula C23H23N3O3S and a molecular weight of 421.52 g/mol. Its IUPAC name is methyl (2R)-4-(1-benzyl-3-phenylpyrazole-4-carbonyl)thiomorpholine-2-carboxylate.
| Compound Name | methyl (2R)-4-(1-benzyl-3-phenylpyrazole-4-carbonyl)thiomorpholine-2-carboxylate |
|---|---|
| PubChem CID | 9272475 |
| Molecular Formula | C23H23N3O3S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | methyl (2R)-4-(1-benzyl-3-phenylpyrazole-4-carbonyl)thiomorpholine-2-carboxylate |
| SMILES | COC(=O)[C@H]1CN(C(=O)c2cn(Cc3ccccc3)nc2-c2ccccc2)CCS1 |
| InChI | InChI=1S/C23H23N3O3S/c1-29-23(28)20-16-25(12-13-30-20)22(27)19-15-26(14-17-8-4-2-5-9-17)24-21(19)18-10-6-3-7-11-18/h2-11,15,20H,12-14,16H2,1H3/t20-/m1/s1 |
| InChIKey | KFGXYWAGMSHFPC-HXUWFJFHSA-N |
| XLogP | 3.33 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |