C25H31N4O+ — CID 8006130
[1-benzyl-3-(4-methylphenyl)pyrazol-4-yl]-(4-propylpiperazin-4-ium-1-yl)methanone (PubChem CID 8006130) has the molecular formula C25H31N4O+ and a molecular weight of 403.55 g/mol. Its IUPAC name is [1-benzyl-3-(4-methylphenyl)pyrazol-4-yl]-(4-propylpiperazin-4-ium-1-yl)methanone.
| Compound Name | [1-benzyl-3-(4-methylphenyl)pyrazol-4-yl]-(4-propylpiperazin-4-ium-1-yl)methanone |
|---|---|
| PubChem CID | 8006130 |
| Molecular Formula | C25H31N4O+ |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | [1-benzyl-3-(4-methylphenyl)pyrazol-4-yl]-(4-propylpiperazin-4-ium-1-yl)methanone |
| SMILES | CCC[NH+]1CCN(C(=O)c2cn(Cc3ccccc3)nc2-c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C25H30N4O/c1-3-13-27-14-16-28(17-15-27)25(30)23-19-29(18-21-7-5-4-6-8-21)26-24(23)22-11-9-20(2)10-12-22/h4-12,19H,3,13-18H2,1-2H3/p+1 |
| InChIKey | WREKCHJTRCEVAX-UHFFFAOYSA-O |
| XLogP | 2.66 |
| TPSA | 42.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |