C27H26ClN5O — CID 55493749
[1-benzyl-3-(4-chlorophenyl)pyrazol-4-yl]-[4-(pyridin-3-ylmethyl)piperazin-1-yl]methanone (PubChem CID 55493749) has the molecular formula C27H26ClN5O and a molecular weight of 471.99 g/mol. Its IUPAC name is [1-benzyl-3-(4-chlorophenyl)pyrazol-4-yl]-[4-(pyridin-3-ylmethyl)piperazin-1-yl]methanone.
| Compound Name | [1-benzyl-3-(4-chlorophenyl)pyrazol-4-yl]-[4-(pyridin-3-ylmethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 55493749 |
| Molecular Formula | C27H26ClN5O |
| Molecular Weight | 471.99 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | [1-benzyl-3-(4-chlorophenyl)pyrazol-4-yl]-[4-(pyridin-3-ylmethyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cn(Cc2ccccc2)nc1-c1ccc(Cl)cc1)N1CCN(Cc2cccnc2)CC1 |
| InChI | InChI=1S/C27H26ClN5O/c28-24-10-8-23(9-11-24)26-25(20-33(30-26)19-21-5-2-1-3-6-21)27(34)32-15-13-31(14-16-32)18-22-7-4-12-29-17-22/h1-12,17,20H,13-16,18-19H2 |
| InChIKey | YZBGXEKAZPFEJE-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.99 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |