C19H16N2O4S — CID 55377487
(5-methyl-2-oxooxolan-3-yl) 1-phenyl-3-thiophen-2-ylpyrazole-4-carboxylate (PubChem CID 55377487) has the molecular formula C19H16N2O4S and a molecular weight of 368.41 g/mol. Its IUPAC name is (5-methyl-2-oxooxolan-3-yl) 1-phenyl-3-thiophen-2-ylpyrazole-4-carboxylate.
| Compound Name | (5-methyl-2-oxooxolan-3-yl) 1-phenyl-3-thiophen-2-ylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 55377487 |
| Molecular Formula | C19H16N2O4S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | (5-methyl-2-oxooxolan-3-yl) 1-phenyl-3-thiophen-2-ylpyrazole-4-carboxylate |
| SMILES | CC1CC(OC(=O)c2cn(-c3ccccc3)nc2-c2cccs2)C(=O)O1 |
| InChI | InChI=1S/C19H16N2O4S/c1-12-10-15(19(23)24-12)25-18(22)14-11-21(13-6-3-2-4-7-13)20-17(14)16-8-5-9-26-16/h2-9,11-12,15H,10H2,1H3 |
| InChIKey | XYBLUQDJDUTTHG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |