C16H11N3O2S — CID 2579298
cyanomethyl 1-phenyl-3-thiophen-2-ylpyrazole-4-carboxylate (PubChem CID 2579298) has the molecular formula C16H11N3O2S and a molecular weight of 309.35 g/mol. Its IUPAC name is cyanomethyl 1-phenyl-3-thiophen-2-ylpyrazole-4-carboxylate.
| Compound Name | cyanomethyl 1-phenyl-3-thiophen-2-ylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 2579298 |
| Molecular Formula | C16H11N3O2S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | cyanomethyl 1-phenyl-3-thiophen-2-ylpyrazole-4-carboxylate |
| SMILES | N#CCOC(=O)c1cn(-c2ccccc2)nc1-c1cccs1 |
| InChI | InChI=1S/C16H11N3O2S/c17-8-9-21-16(20)13-11-19(12-5-2-1-3-6-12)18-15(13)14-7-4-10-22-14/h1-7,10-11H,9H2 |
| InChIKey | FLXODSDFLLCCBO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |