C17H16N2O3S — CID 27914141
2-methoxyethyl 1-phenyl-3-thiophen-2-ylpyrazole-4-carboxylate (PubChem CID 27914141) has the molecular formula C17H16N2O3S and a molecular weight of 328.39 g/mol. Its IUPAC name is 2-methoxyethyl 1-phenyl-3-thiophen-2-ylpyrazole-4-carboxylate.
| Compound Name | 2-methoxyethyl 1-phenyl-3-thiophen-2-ylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 27914141 |
| Molecular Formula | C17H16N2O3S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 2-methoxyethyl 1-phenyl-3-thiophen-2-ylpyrazole-4-carboxylate |
| SMILES | COCCOC(=O)c1cn(-c2ccccc2)nc1-c1cccs1 |
| InChI | InChI=1S/C17H16N2O3S/c1-21-9-10-22-17(20)14-12-19(13-6-3-2-4-7-13)18-16(14)15-8-5-11-23-15/h2-8,11-12H,9-10H2,1H3 |
| InChIKey | JJRDSLSDIZYHCY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|