C28H31N3O6S — CID 2873581
bis(2-methoxyethyl) 2,6-dimethyl-4-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 2873581) has the molecular formula C28H31N3O6S and a molecular weight of 537.64 g/mol. Its IUPAC name is bis(2-methoxyethyl) 2,6-dimethyl-4-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | bis(2-methoxyethyl) 2,6-dimethyl-4-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 2873581 |
| Molecular Formula | C28H31N3O6S |
| Molecular Weight | 537.64 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | bis(2-methoxyethyl) 2,6-dimethyl-4-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COCCOC(=O)C1=C(C)NC(C)=C(C(=O)OCCOC)C1c1cn(-c2ccccc2)nc1-c1cccs1 |
| InChI | InChI=1S/C28H31N3O6S/c1-18-23(27(32)36-14-12-34-3)25(24(19(2)29-18)28(33)37-15-13-35-4)21-17-31(20-9-6-5-7-10-20)30-26(21)22-11-8-16-38-22/h5-11,16-17,25,29H,12-15H2,1-4H3 |
| InChIKey | KPFYBQQCEKNIGR-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.64 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|