C28H29N4O5- — CID 140600717
diethyl 2,6-dimethyl-4-[3-[3-(oxidoamino)phenyl]-1-phenylpyrazol-4-yl]-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 140600717) has the molecular formula C28H29N4O5- and a molecular weight of 501.56 g/mol. Its IUPAC name is diethyl 2,6-dimethyl-4-[3-[3-(oxidoamino)phenyl]-1-phenylpyrazol-4-yl]-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | diethyl 2,6-dimethyl-4-[3-[3-(oxidoamino)phenyl]-1-phenylpyrazol-4-yl]-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 140600717 |
| Molecular Formula | C28H29N4O5- |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | diethyl 2,6-dimethyl-4-[3-[3-(oxidoamino)phenyl]-1-phenylpyrazol-4-yl]-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1c1cn(-c2ccccc2)nc1-c1cccc(N[O-])c1 |
| InChI | InChI=1S/C28H29N4O5/c1-5-36-27(33)23-17(3)29-18(4)24(28(34)37-6-2)25(23)22-16-32(21-13-8-7-9-14-21)30-26(22)19-11-10-12-20(15-19)31-35/h7-16,25,29,31H,5-6H2,1-4H3/q-1 |
| InChIKey | RWZSDNGDMBDBFE-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|