C33H39N3O5 — CID 5001123
diethyl 4-[3-(4-butoxy-3-methylphenyl)-1-phenylpyrazol-4-yl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 5001123) has the molecular formula C33H39N3O5 and a molecular weight of 557.69 g/mol. Its IUPAC name is diethyl 4-[3-(4-butoxy-3-methylphenyl)-1-phenylpyrazol-4-yl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | diethyl 4-[3-(4-butoxy-3-methylphenyl)-1-phenylpyrazol-4-yl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 5001123 |
| Molecular Formula | C33H39N3O5 |
| Molecular Weight | 557.69 g/mol |
| Exact Mass | 557.29 |
| IUPAC Name | diethyl 4-[3-(4-butoxy-3-methylphenyl)-1-phenylpyrazol-4-yl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCCCOc1ccc(-c2nn(-c3ccccc3)cc2C2C(C(=O)OCC)=C(C)NC(C)=C2C(=O)OCC)cc1C |
| InChI | InChI=1S/C33H39N3O5/c1-7-10-18-41-27-17-16-24(19-21(27)4)31-26(20-36(35-31)25-14-12-11-13-15-25)30-28(32(37)39-8-2)22(5)34-23(6)29(30)33(38)40-9-3/h11-17,19-20,30,34H,7-10,18H2,1-6H3 |
| InChIKey | UNGASXBUBMGKKK-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.69 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|