C28H31N4O6- — CID 160752427
diethyl 2,6-dimethyl-4-[3-[3-(oxidoamino)phenyl]-1-phenylpyrazol-4-yl]-1,4-dihydropyridine-3,5-dicarboxylate;hydrate (PubChem CID 160752427) has the molecular formula C28H31N4O6- and a molecular weight of 519.58 g/mol. Its IUPAC name is diethyl 2,6-dimethyl-4-[3-[3-(oxidoamino)phenyl]-1-phenylpyrazol-4-yl]-1,4-dihydropyridine-3,5-dicarboxylate;hydrate.
| Compound Name | diethyl 2,6-dimethyl-4-[3-[3-(oxidoamino)phenyl]-1-phenylpyrazol-4-yl]-1,4-dihydropyridine-3,5-dicarboxylate;hydrate |
|---|---|
| PubChem CID | 160752427 |
| Molecular Formula | C28H31N4O6- |
| Molecular Weight | 519.58 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | diethyl 2,6-dimethyl-4-[3-[3-(oxidoamino)phenyl]-1-phenylpyrazol-4-yl]-1,4-dihydropyridine-3,5-dicarboxylate;hydrate |
| SMILES | CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1c1cn(-c2ccccc2)nc1-c1cccc(N[O-])c1.O |
| InChI | InChI=1S/C28H29N4O5.H2O/c1-5-36-27(33)23-17(3)29-18(4)24(28(34)37-6-2)25(23)22-16-32(21-13-8-7-9-14-21)30-26(22)19-11-10-12-20(15-19)31-35;/h7-16,25,29,31H,5-6H2,1-4H3;1H2/q-1; |
| InChIKey | UQFRLUBUNIGUJG-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 149.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.58 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|