C20H18N2O3S — CID 7841183
[(1S)-2-oxocyclohexyl] 1-phenyl-3-thiophen-2-ylpyrazole-4-carboxylate (PubChem CID 7841183) has the molecular formula C20H18N2O3S and a molecular weight of 366.44 g/mol. Its IUPAC name is [(1S)-2-oxocyclohexyl] 1-phenyl-3-thiophen-2-ylpyrazole-4-carboxylate.
| Compound Name | [(1S)-2-oxocyclohexyl] 1-phenyl-3-thiophen-2-ylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 7841183 |
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | [(1S)-2-oxocyclohexyl] 1-phenyl-3-thiophen-2-ylpyrazole-4-carboxylate |
| SMILES | O=C(O[C@H]1CCCCC1=O)c1cn(-c2ccccc2)nc1-c1cccs1 |
| InChI | InChI=1S/C20H18N2O3S/c23-16-9-4-5-10-17(16)25-20(24)15-13-22(14-7-2-1-3-8-14)21-19(15)18-11-6-12-26-18/h1-3,6-8,11-13,17H,4-5,9-10H2/t17-/m0/s1 |
| InChIKey | BNJAUSWWUDRNTH-KRWDZBQOSA-N |
| XLogP | 4.27 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |