C19H21ClN4OS — CID 119375478
(4-aminopiperidin-1-yl)-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methanone;hydrochloride (PubChem CID 119375478) has the molecular formula C19H21ClN4OS and a molecular weight of 388.92 g/mol. Its IUPAC name is (4-aminopiperidin-1-yl)-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methanone;hydrochloride.
| Compound Name | (4-aminopiperidin-1-yl)-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119375478 |
| Molecular Formula | C19H21ClN4OS |
| Molecular Weight | 388.92 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | (4-aminopiperidin-1-yl)-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methanone;hydrochloride |
| SMILES | Cl.NC1CCN(C(=O)c2cn(-c3ccccc3)nc2-c2cccs2)CC1 |
| InChI | InChI=1S/C19H20N4OS.ClH/c20-14-8-10-22(11-9-14)19(24)16-13-23(15-5-2-1-3-6-15)21-18(16)17-7-4-12-25-17;/h1-7,12-14H,8-11,20H2;1H |
| InChIKey | FDHPEYRAGQWFEV-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.92 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |