C23H22N4O3S3 — CID 46565675
N-[1-(1-phenyl-3-thiophen-2-ylpyrazole-4-carbonyl)piperidin-4-yl]thiophene-2-sulfonamide (PubChem CID 46565675) has the molecular formula C23H22N4O3S3 and a molecular weight of 498.66 g/mol. Its IUPAC name is N-[1-(1-phenyl-3-thiophen-2-ylpyrazole-4-carbonyl)piperidin-4-yl]thiophene-2-sulfonamide.
| Compound Name | N-[1-(1-phenyl-3-thiophen-2-ylpyrazole-4-carbonyl)piperidin-4-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 46565675 |
| Molecular Formula | C23H22N4O3S3 |
| Molecular Weight | 498.66 g/mol |
| Exact Mass | 498.09 |
| IUPAC Name | N-[1-(1-phenyl-3-thiophen-2-ylpyrazole-4-carbonyl)piperidin-4-yl]thiophene-2-sulfonamide |
| SMILES | O=C(c1cn(-c2ccccc2)nc1-c1cccs1)N1CCC(NS(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C23H22N4O3S3/c28-23(26-12-10-17(11-13-26)25-33(29,30)21-9-5-15-32-21)19-16-27(18-6-2-1-3-7-18)24-22(19)20-8-4-14-31-20/h1-9,14-17,25H,10-13H2 |
| InChIKey | BBONDHPWVGMQGR-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.66 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |