C24H19BrN2O3S — CID 4672579
2-(3-bromophenoxy)ethyl 3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enoate (PubChem CID 4672579) has the molecular formula C24H19BrN2O3S and a molecular weight of 495.40 g/mol. Its IUPAC name is 2-(3-bromophenoxy)ethyl 3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enoate.
| Compound Name | 2-(3-bromophenoxy)ethyl 3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 4672579 |
| Molecular Formula | C24H19BrN2O3S |
| Molecular Weight | 495.40 g/mol |
| Exact Mass | 494.03 |
| IUPAC Name | 2-(3-bromophenoxy)ethyl 3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enoate |
| SMILES | O=C(C=Cc1cn(-c2ccccc2)nc1-c1cccs1)OCCOc1cccc(Br)c1 |
| InChI | InChI=1S/C24H19BrN2O3S/c25-19-6-4-9-21(16-19)29-13-14-30-23(28)12-11-18-17-27(20-7-2-1-3-8-20)26-24(18)22-10-5-15-31-22/h1-12,15-17H,13-14H2 |
| InChIKey | IXMNHZONDQHQJP-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.40 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|