C31H25N3O4S — CID 2424632
[(1R)-2-(3-methoxyanilino)-2-oxo-1-phenylethyl] (E)-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enoate (PubChem CID 2424632) has the molecular formula C31H25N3O4S and a molecular weight of 535.63 g/mol. Its IUPAC name is [(1R)-2-(3-methoxyanilino)-2-oxo-1-phenylethyl] (E)-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enoate.
| Compound Name | [(1R)-2-(3-methoxyanilino)-2-oxo-1-phenylethyl] (E)-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 2424632 |
| Molecular Formula | C31H25N3O4S |
| Molecular Weight | 535.63 g/mol |
| Exact Mass | 535.16 |
| IUPAC Name | [(1R)-2-(3-methoxyanilino)-2-oxo-1-phenylethyl] (E)-3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enoate |
| SMILES | COc1cccc(NC(=O)[C@H](OC(=O)/C=C/c2cn(-c3ccccc3)nc2-c2cccs2)c2ccccc2)c1 |
| InChI | InChI=1S/C31H25N3O4S/c1-37-26-15-8-12-24(20-26)32-31(36)30(22-10-4-2-5-11-22)38-28(35)18-17-23-21-34(25-13-6-3-7-14-25)33-29(23)27-16-9-19-39-27/h2-21,30H,1H3,(H,32,36)/b18-17+/t30-/m1/s1 |
| InChIKey | IPVSYUFOROTVQI-CGNIEOBSSA-N |
| XLogP | 6.55 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.63 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|