C15H12N2O3S — CID 114798384
1-(3-methoxyphenyl)-3-thiophen-2-ylpyrazole-4-carboxylic acid (PubChem CID 114798384) has the molecular formula C15H12N2O3S and a molecular weight of 300.34 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-3-thiophen-2-ylpyrazole-4-carboxylic acid.
| Compound Name | 1-(3-methoxyphenyl)-3-thiophen-2-ylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 114798384 |
| Molecular Formula | C15H12N2O3S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 1-(3-methoxyphenyl)-3-thiophen-2-ylpyrazole-4-carboxylic acid |
| SMILES | COc1cccc(-n2cc(C(=O)O)c(-c3cccs3)n2)c1 |
| InChI | InChI=1S/C15H12N2O3S/c1-20-11-5-2-4-10(8-11)17-9-12(15(18)19)14(16-17)13-6-3-7-21-13/h2-9H,1H3,(H,18,19) |
| InChIKey | OAVPTXUVKRJWPG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |