C24H17N3O2S — CID 3947532
(2-cyanophenyl)methyl 3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enoate (PubChem CID 3947532) has the molecular formula C24H17N3O2S and a molecular weight of 411.49 g/mol. Its IUPAC name is (2-cyanophenyl)methyl 3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enoate.
| Compound Name | (2-cyanophenyl)methyl 3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 3947532 |
| Molecular Formula | C24H17N3O2S |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | (2-cyanophenyl)methyl 3-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enoate |
| SMILES | N#Cc1ccccc1COC(=O)C=Cc1cn(-c2ccccc2)nc1-c1cccs1 |
| InChI | InChI=1S/C24H17N3O2S/c25-15-18-7-4-5-8-20(18)17-29-23(28)13-12-19-16-27(21-9-2-1-3-10-21)26-24(19)22-11-6-14-30-22/h1-14,16H,17H2 |
| InChIKey | PRNUZODGVUZHFK-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|